Tetrahydromethyl-1,3-isobenzofurandione CAS Number: 11070-44-3
| Product | Tetrahydromethyl-1,3-isobenzofurandione |
| CAS | 11070-44-3 |
| MF | C9H10O3 |
| Formula | 4-METHYLTETRAHYDROPHTHALICANHYDRIDE;3-METHYL-DELTA4-TETRAHYDROPHTHALICANHYDRIDE;3-METHYL-4-CYCLOHEXENE-1,2-DICARBOXYLICANHYDRIDE;3-METHYL-4-CYCLOHEXEN-1,2-DICARBOXYLChemicalbookICANHYDRIDE;AC-METHYL;1,3-Isobenzofurandione,3a,4;4-methyl-3a,4,7,7a-tetrahydroisobenzofuran-1,3-quinone;cis,cis-3-Methyl-4-cyclohexene-1,2-dicarboxylicacidanhydride |
product description
Basic Info.
Tetrahydromethyl-1,3-isobenzofurandione Properties
| Melting point | <-100.00°C |
|---|---|
| Boiling point | 120 °C/3 mmHg |
| Density | 1,21 g/cm3 |
| vapor pressure | 0.373Pa at 24.85℃ |
| refractive index | 1.4970 to 1.5020 |
| Flash point | 157 °C |
| storage temp. | Storage temp. 2-8°C |
| Water Solubility | Soluble in water |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C9H10O3/c1-5-3-2-4-6-7(5)9(11)12-8(6)10/h2-3,5-7H,4H2,1H3 |
| InChIKey | XPEKVUUBSDFMDR-UHFFFAOYSA-N |
| SMILES | C12C(C)C=CCC1C(OC2=O)=O |
| LogP | 2.45 at 20℃ |
| CAS DataBase Reference | 11070-44-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1,3-Isobenzofurandione, tetrahydromethyl- (11070-44-3) |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |     GHS05,GHS07,GHS08,GHS09 |
|---|---|
| Signal word | Danger |
| Hazard statements | H302+H312-H315-H318-H317-H334-H335-H336-H402-H411 |
| Precautionary statements | P501-P261-P273-P272-P270-P271-P264-P280-P284-P391-P342+P311-P362+P364-P333+P313-P301+P312+P330-P302+P352+P312-P304+P340+P312-P305+P351+P338+P310-P403+P233-P405 |
| Hazard Codes | Xn |
| Risk Statements | 36/37/38-42/43-41 |
| Safety Statements | 26-36/37/39-37/39-24-22 |
| RIDADR | UN 3082 9/PG III |
| RTECS | TI3325000 |
| TSCA | TSCA listed |
| HS Code | 2917.20.0000 |
| HazardClass | 9 |
| PackingGroup | III |
etrahydromethyl-1,3-isobenzofurandione Chemical Properties,Uses,Production
Chemical Properties
colorless or light yellow liquid
Uses
Methyltetrahydrophthalic Anhydride (abbreviation:MTHPA) has been used in the curing agents for epoxy resins, solvent-free paints,laminated boards, epoxy adhesives and so on. When used in the curing agent for epoxy resins, there are many excellent performances such as the long-term storage at room temperature, low freezing point, low volatility and low toxicity. Also widely used in motors, dry-type transformers, appliances capacitors, power capacitors, integrated circuits impregnation, casting and winding.
Uses
Methyltetrahydrophthalic Anhydride (MTHPA) is used in preparation method of conductive adhesive.
Flammability and Explosibility
Non flammable
Tetrahydromethyl-1,3-isobenzofurandione Preparation Products And Raw materials
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp：008615950692266 email：md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |
