Methyl-5-norbornene-2,3-dicarboxylic anhydride CAS Number: 25134-21-8
| Product | Methyl-5-norbornene-2,3-dicarboxylic anhydride |
| CAS | 25134-21-8 |
| MF | C10H10O3 |
| Formula | NADICMETHYLANHYDRIDE;NADIC(R)METHYLANHYDRIDE;NADIC(TM)METHYLANHYDRIDE;NMA;MNA;3-dione,3a,4,7,7a-tetrahydromethyl-7-methanoisobenzofuran-1;
4,7-MethanoisobeChemicalbooknzofuran-1,3-dione,3a,4,7,7a-tetrahydromethyl-,(3aalpha,4alpha,7alpha,7aalpha)-;4,7-methanoisobenzofuran-1,3-dione,3a,4,7,7a-tetrahydromethyl-,(3aalpha,4al |
product description
Basic Info.
Methyl-5-norbornene-2,3-dicarboxylic anhydride Properties
| Boiling point | 140°C (10 mmHg) |
|---|---|
| Density | 1.232 g/mL at 25 °C(lit.) |
| vapor density | 6.1 (20 °C, vs air) |
| vapor pressure | 5 mm Hg ( 120 °C) |
| refractive index | n20/D 1.506(lit.) |
| Flash point | >230 °F |
| storage temp. | room temp |
| solubility | Miscible with acetone, benzene, naphtha and xylene. |
| pka | 4.42[at 20 ℃] |
| form | Oily Liquid |
| color | Clear light yellow |
| biological source | synthetic |
| Water Solubility | REACTS |
| Sensitive | Moisture Sensitive |
| BRN | 162395 |
| Major Application | hematology histology |
| InChI | 1S/C10H10O3/c1-10-6-3-2-5(4-6)7(10)8(11)13-9(10)12/h2-3,5-7H,4H2,1H3/t5-,6+,7+,10+/m0/s1 |
| InChIKey | LTVUCOSIZFEASK-MPXCPUAZSA-N |
| SMILES | [H][C@]12C3CC(C(C)=C3)[C@@]1([H])C(=O)OC2=O |
| LogP | -4.01 at 20℃ |
| Indirect Additives used in Food Contact Substances | METHYL-5-NORBORNENE-2,3-DICARBOXYLIC ANHYDRIDE |
| CAS DataBase Reference | 25134-21-8(CAS DataBase Reference) |
| EWG’s Food Scores | 1 |
| NIST Chemistry Reference | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydromethyl-(25134-21-8) |
| EPA Substance Registry System | 4,7-Methanoisobenzofuran-1,3-dione, 3a,4,7,7a-tetrahydromethyl-, (3aR,4S,7R,7aS)-rel- (25134-21-8) |
| UNSPSC Code | 41102904 |
| NACRES | NA.22 |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |    GHS05,GHS07,GHS08 |
|---|---|
| Signal word | Danger |
| Hazard statements | H302-H314-H317-H334 |
| Precautionary statements | P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,C |
| Risk Statements | 22-36/37/38-42-34 |
| Safety Statements | 39-45-36/37/39-26 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | RB9100000 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29172000 |
| Storage Class | 8A – Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Resp. Sens. 1 Skin Corr. 1C Skin Sens. 1 |
| Hazardous Substances Data | 25134-21-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 914mg/kg |
Methyl-5-norbornene-2,3-dicarboxylic anhydride Chemical Properties,Uses,Production
Chemical Properties
clear light yellow oily liquid
Uses
Methyl-5-norbornene-2,3-dicarboxylic anhydride is used as a curing agent in epoxy resins and in the preparation of vertically aligned and penetrated carbon nanotube/polymer film. It serves as an intermediate in polyesters, alkyd resins and plasticizers. It is also used in electrical laminating and filament-winding. Further, it is used in the preparation of methyl nadimides endcapped resins based on tris(3-aminophenyl)phosphine oxide. It is utilized in the flame retarding treatment.
General Description
additional information see 45359 Epoxy Embedding Medium kit
Flammability and Explosibility
Non flammable
Purification Methods
Purify the anhydride by thin layer chromatography on Al2O3 (previously boiled in EtOAc) and eluted with hexane/*C6H6 (1:2) then recrystallise it from *C6H6/hexane. The free acid has m 118.5-119.5o. [Miranov et al. Tetrahedron 19 1939 1963, Beilstein 17/11 V 199.]
Methyl-5-norbornene-2,3-dicarboxylic anhydride Preparation Products And Raw materials
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp：008615950692266 email：md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |
