Benzyltrimethylammonium chloride CAS Number: 56-93-9
| Product | Benzyltrimethylammonium chloride |
| CAS | 56-93-9 |
| MF | C10H16ClN |
| Formula | Benzenemethanaminium,N,N,N-trimethyl-,chloride;benzyltrimethyl-ammoniuchloride;Benzyltrimethylammoniumchlori;n,n,Chemicalbookn-trimethyl-benzenemethanaminiuchloride;BTM;
N,N,N-Trimethylbenzenemethanaminiumchloride;TMBAC;(+)-Benzotetramisole |
product description
Basic Info.
Benzyltrimethylammonium chloride Properties
| Melting point | 239 °C (dec.) (lit.) |
|---|---|
| Boiling point | 305.52°C (rough estimate) |
| Density | 1.08 g/mL at 25 °C |
| vapor pressure | <0.0001 hPa (20 °C) |
| refractive index | n20/D 1.479 |
| Flash point | |
| storage temp. | Store below +30°C. |
| solubility | 800g/l |
| form | Crystalline Powder or Chunks |
| color | White to ivory |
| Odor | Faint, almond like odor |
| PH | 6-8 (100g/l, H2O, 20℃) |
| PH Range | 6 – 8 |
| Evaporation Rate | <1 |
| Water Solubility | 800 g/L |
| Sensitive | Hygroscopic |
| BRN | 3917255 |
| Stability | Stable. Hygroscopic. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H16N.ClH/c1-11(2,3)9-10-7-5-4-6-8-10;/h4-8H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KXHPPCXNWTUNSB-UHFFFAOYSA-M |
| SMILES | [Cl-].C[N+](C)(C)Cc1ccccc1 |
| Indirect Additives used in Food Contact Substances | BENZYLTRIMETHYLAMMONIUM CHLORIDE |
| CAS DataBase Reference | 56-93-9(CAS DataBase Reference) |
| FDA 21 CFR | 177.2420 |
| FDA UNII | VNK45Y7BA1 |
| EPA Substance Registry System | Benzyltrimethylammonium chloride (56-93-9) |
| UNSPSC Code | 12352107 |
| NACRES | NA.22 |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |   GHS06,GHS08 |
|---|---|
| Signal word | Danger |
| Hazard statements | H301+H311-H332-H341-H412 |
| Precautionary statements | P201-P273-P280-P301+P310-P302+P352+P312-P304+P340+P312 |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/38-36 |
| Safety Statements | 26-37/39 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | BO8400000 |
| F | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29239000 |
| Storage Class | 6.1D – Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Chronic 3 Muta. 2 |
| Hazardous Substances Data | 56-93-9(Hazardous Substances Data) |
| Toxicity | LD50 orally in Rabbit: 500 mg/kg |
Benzyltrimethylammonium chloride Chemical Properties,Uses,Production
Chemical Properties
white to light yellow crystal powde
Uses
Solvent for cellulose, gelling inhibitor in polyester resins, intermediate.
Uses
Benzyltrimethylammonium chloride are Ccommercially important catalyst. Used in antistatic agent, detergent Sanitisers, softner for textiles and paper products, phase transfer catalyst.
General Description
Light yellow liquid with a mild almond odor. May float or sink in water.
Air & Water Reactions
Water soluble.
Reactivity Profile
Benzyltrimethylammonium chloride can react with oxidizing materials . Toxic oxides of nitrogen and hydrochloric acid fumes may form in fire [USCG, 1999].
Health Hazard
Ingestion causes gastrointestinal disturbances. Contact with liquid irritates eyes and may irritate skin.
Fire Hazard
Special Hazards of Combustion Products: Toxic oxides of nitrogen and hydrochloric acid fumes may form in fire.
Safety Profile
Poison by ingestion. Combustible.When heated to decomposition it emits very toxic fumesof NH3, NOx, and Cl??.
Purification Methods
A 60% aqueous solution of the salt is evaporated to dryness under a vacuum on a steam bath, and then left in a vacuum desiccator containing a suitable drying agent. The solid residue is dissolved in a small volume of boiling absolute EtOH and precipitated by adding an equal volume of diethyl ether with cooling. After washing, the precipitate is dried under a vacuum [Karusch J Am Chem Soc 73 1246 1951]. [Beilstein 12 IV 2162.]
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp：008615950692266 email：md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |
