2-Ethylhexyl nitrate CAS Number: 27247-96-7
| Product | 2-Ethylhexyl nitrate |
| CAS | 27247-96-7 |
| MF | C8H17NO3 |
| Formula | ethylhexylnitrate;Nitricacid,2-ethylhexylester;nitronal;salpetersaure-(2-ethylhexyl)ester;2-Ethylhexylnitrat;OCTYL NITRATE (2-ETHYL HEXYL NITRATE);2-ETHYLHEXYL NITRATE;2-ETHYL-HEXYL-1-NITRATE |
product description
Basic Info.
2-Ethylhexyl nitrate Properties
| Boiling point | 306.53°C (rough estimate) |
|---|---|
| Density | 0.963 g/mL at 25 °C(lit.) |
| vapor pressure | 27Pa at 20℃ |
| refractive index | n20/D 1.432(lit.) |
| Flash point | 168 °F |
| Appearance | olourless to pale yellow liquid |
| Odor | Fruity, pungent, ester, characteristic |
| Viscosity | 1.8 cSt @ 20℃ |
| Water Solubility | 12.5mg/L at 20℃ |
| Decomposition | >100℃ |
| Stability | Stability Heating may cause an explosion. Contact with combustible material may cause fire or explosion. |
| InChI | InChI=1S/C8H17NO3/c1-3-5-6-8(4-2)7-12-9(10)11/h8H,3-7H2,1-2H3 |
| InChIKey | NKRVGWFEFKCZAP-UHFFFAOYSA-N |
| SMILES | [N+]([O-])(=O)OCC(CC)CCCC |
| LogP | 5.24 at 40℃ |
| CAS DataBase Reference | 27247-96-7(CAS DataBase Reference) |
| FDA UNII | R11MG529IT |
| EPA Substance Registry System | 2-Ethylhexyl nitrate (27247-96-7) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |   GHS07,GHS09 |
|---|---|
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H411 |
| Precautionary statements | P273-P280-P301+P312+P330-P302+P352+P312-P304+P340+P312 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | O,Xn,N |
| Risk Statements | 5-8-20/21/22-36/37/38-66-51/53-44 |
| Safety Statements | 15-26-27-36/37/39-61-60-24/25 |
| RIDADR | UN 3139 5.1/PG 2 |
| OEL | 0.25% v/v in air |
| WGK Germany | 2 |
| RTECS | QU7925000 |
| Autoignition Temperature | 130℃ – (decomposes) |
| TSCA | TSCA listed |
| HazardClass | 9 |
| Storage Class | 10 – Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 2 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
2-Ethylhexyl nitrate Chemical Properties,Uses,Production
Chemical Properties
solid
Uses
2-Ethylhexyl nitrate (2-EHN) is a major fuel additive, has been used to increase the cetane number of diesel.
General Description
Biodegradation of 2-ethylhexyl nitrate (2-EHN) by Mycobacterium austroafricanum IFP 2173 has been studied. Biodegradation of 2-EHN was studied in biphasic liquid cultures using an inert non-aqueous phase liquid such as 2,2,4,4,6,8,8-heptamethylnonane as solvent.
Flammability and Explosibility
Not classified
Synthesis
A production method of 2-Ethylhexyl nitrate, the steps are: (1) 1500L reactor add 100 kg of 98% nitric acid, water cooling, vigorous stirring under the addition of 424 kg of 87% sulfuric acid, made of sulfuric acid and nitric acid acid mixture; (2) 156 kg of isooctyl nitrate to 195 kg of iso-octanol and mix it well; (3) (2) isooctyl nitrate and iso-octanol mixture prepared by adding to the (1) mixed acid. (3) The mixture of isooctyl nitrate and isooctanol prepared in (2) was added to the mixed acid prepared in (1), the process of adding speed control to keep the reaction temperature between 10-30 ??, add the stirring reaction for 45 minutes, static liquid separation, organic phase alkali washing, water washing, to obtain the product of isooctyl nitrate purity of 99.1%, the yield of 98.2%.
2-Ethylhexyl nitrate Preparation Products And Raw materials
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp：008615950692266 email：md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |
