Methylhexahydrophthalic anhydride CAS Number: 25550-51-0
| Product | Methylhexahydrophthalic anhydride |
| CAS | 25550-51-0 |
| MF | C9H12O3 |
| Formula | VLOOKUP(C14,[1]Export!$D:$H,5,0);hexahydromethyl-1,3-Isobenzofurandione;Methylhexahydrophthalicanhydrid;1.MethylHexahyd;HexahydromethylphthalsureanChemicalbookhydrid;
methyl-1,2-cyclohexanedicarboxylicanhydridemixtureofisomers;1,3-Isobenzofurandione,hexahydromethyl-;1.MethylHexahydrophthalicAnhydride(MHHPA) |
product description
Basic Info.
Methylhexahydrophthalic anhydride Properties
| Boiling point | 299℃[at 101 325 Pa] |
|---|---|
| Density | 1.162 |
| vapor pressure | 0.274Pa at 25℃ |
| refractive index | 1.479Nd(25°C) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| pka | 4.12[at 20 ℃] |
| form | Oil |
| color | Colourless |
| Viscosity | 50-70mPa.s(25°C) |
| Stability | Moisture Sensitive |
| InChI | InChI=1S/C9H12O3/c1-9-5-3-2-4-6(9)7(10)12-8(9)11/h6H,2-5H2,1H3 |
| InChIKey | VYKXQOYUCMREIS-UHFFFAOYSA-N |
| SMILES | C1(OC(=O)C2CCCCC12C)=O |
| LogP | 2.59 at 25℃ |
| Substances of Very High Concern (SVHC) Candidate List | Hexahydromethylphthalic anhydride (25550-51-0) |
| CAS DataBase Reference | 25550-51-0(CAS DataBase Reference) |
| EPA Substance Registry System | Methylhexahydrophthalic anhydride (25550-51-0) |
SAFETY
Risk and Safety Statements
| Symbol(GHS) |   GHS08,GHS05 |
|---|---|
| Signal word | Danger |
| Hazard statements | H317-H334-H318 |
| Precautionary statements | P261-P272-P280-P302+P352-P333+P313-P321-P363-P501-P261-P285-P304+P341-P342+P311-P501-P280-P305+P351+P338-P310 |
| Safety Statements | 24/25 |
| TSCA | TSCA listed |
| HS Code | 29329990 |
Methylhexahydrophthalic anhydride Chemical Properties,Uses,Production
Chemical Properties
colorless clear
Uses
Methylhexahydrophthalic Anhydride(MHHPA) is a hardener for hot-cured epoxy resins in the electric/electronics industry as well as a raw material for polyurethane/polyester resins, adhesives, LEDs, Outdoor High Voltage Castings and Composites, automotive clear coats, insecticide, plasticizer and antirust.
Due to its cycloaliphatic structure and the absence of aromatic bonds, metals or contaminants, MHHPA imparts inequivalent resistance to UV radiation and atmospheric agents.
These characteristics make MHHPA particularly suited for electronic applications, such as high performance LEDs and for automotive clear coats. In addition, MHHPA exhibits outstanding mechanical and electrical properties, as well as excellent color retention.
Definition
ChEBI: Methylhexahydrophthalic anhydride is a cyclic dicarboxylic anhydride that is the cyclic anhydride of methylhexahydrophthalic acid. It has a role as an allergen and a curing agent. It is a cyclic dicarboxylic anhydride and a tetrahydrofurandione.
Preparation
Methyl hexahydrophthalic anhydride is produced from methyl tetrahydrophthalic anhydride by catalytic hydrogenation. It is a high-performance product among acid anhydride-type solidifying agent.
Flammability and Explosibility
Non flammable
storage
MHHPA must be stored away from open flames or other potential ignition sources, and should be protected from moisture, because it easy crystallizes when it’s in contact with the humidity of the air. When some crystallization occurs, check the properties before reusing.
Methylhexahydrophthalic anhydride Preparation Products And Raw materials
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp：008615950692266 email：md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |
