Isopropylphenyl phosphate CAS Number: 68937-41-7
| Product | Isopropylphenyl phosphate |
| CAS | 68937-41-7 |
| MF | C27H33O4P |
| Formula | Phenol,isopropylated,phosphate(3:1);TRIS(ISOPROPYLPHENYL)PHOSPHATE-1MALKYL;isopropylatedphenolphosphate;ISOPROPYLATEDTRIPHENYChemicalbookLPHOSPHATE;Isopropylphenylphosphate;triisopropylatedphenylphosphate;Phenolphosphateisopropylated;Triarylphosphatisopropylated |
product description
Basic Info.
Isopropylphenyl phosphate Properties
| Boiling point | 400℃[at 101 325 Pa] |
|---|---|
| Density | 1.168[at 20℃] |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Hygroscopic, Refrigerator, under inert atmosphere |
| solubility | Benzene (Slightly), Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| Water Solubility | 330μg/L at 20℃ |
| Stability | Hygroscopic, Moisture Sensitive |
| InChI | InChI=1S/C27H33O4P/c1-19(2)22-7-13-25(14-8-22)29-32(28,30-26-15-9-23(10-16-26)20(3)4)31-27-17-11-24(12-18-27)21(5)6/h7-21H,1-6H3 |
| InChIKey | ANVREEJNGJMLOV-UHFFFAOYSA-N |
| SMILES | P(OC1=CC=C(C(C)C)C=C1)(OC1=CC=C(C(C)C)C=C1)(OC1=CC=C(C(C)C)C=C1)=O |
| LogP | 4.92 at 25℃ |
| CAS DataBase Reference | 68937-41-7(CAS DataBase Reference) |
| EPA Substance Registry System | Isopropylated phenol phosphate (3:1) (68937-41-7) |
SAFETY
Risk and Safety Statements
| Symbol(GHS) | ![]() ![]() GHS08,GHS09 |
|---|---|
| Signal word | Warning |
| Hazard statements | H361-H373-H410 |
| Precautionary statements | P260-P314-P501-P201-P202-P281-P308+P313-P405-P501-P273-P391-P501 |
| RIDADR | 3077 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| Hazardous Substances Data | 68937-41-7(Hazardous Substances Data) |
Isopropylphenyl phosphate Chemical Properties,Uses,Production
Characteristics
Isopropylphenyl phosphate is low viscosity, low toxicity, odourless and non-polluting.
Uses
Isopropylphenyl phosphate, is a flame retardant.
Application
Isopropylphenyl phosphate is commonly used as a plasticising, lubricating, toughening and flame retardant additive in industrial applications.
Synthesis
Triisopropylphenol and POCl3 were synthesized to synthesize triisopropylphenyl phosphate with the reaction formula:
3C3H7C6H5OH+POCl3??(C3H7C6H5)3PO4+3HCl
(1) 230Kg of triisopropylphenol was loaded into the three-necked flask of 250mL with a stirrer, a thermometer, a reflux condenser tube, and a dispensing funnel. Begin to raise the temperature to 70-100 ??, add 550Kg POCl3, control the temperature 75 ?? ~ 130 ??, add calcium and magnesium catalyst 1.15kg, 30-720mmHg under vacuum conditions, the reaction temperature of 75-150 ??, the reaction at the same time the negative pressure discharge of acid, a total of 7-10 hours of reaction;
(2) for distillation under reduced pressure, the pressure of 0.09 -0.1Mpa, take 270-280 ?? fraction for the finished product, get 480g product, yield 87% (in trichlorophosphorus), colorless transparent liquid, that is, triisopropylphenyl phosphate.
Acid value 0.06mgKOH/g, heating reduction 0.05%, flash point 230 ?? (open cup), refractive index 1.554.
Isopropylphenyl phosphate Preparation Products And Raw materials
FAQ
Q1: About the after-sale service of products
A: After purchasing the products from our factory, we have A professional technical team and after-sales team to serve you and solve all your problems in the future.
Q2: Can I get some samples?
A: Yes, we can provide samples, but the customer will pay the freight.
Q3: How do I start paying?
Payment can be made by wire transfer or T/T, apple_pay, google_pay, gc_real_time_bank_transfer , etc.
Q4: How to confirm product quality before placing an order?
A: You can get free samples of some products. You just have to pay the shipping fee or arrange for the sample to be sent to us by express.
You can send us your product specifications and requirements and we will produce products according to your requirements.
Q5: What is your MOQ?
A: The minimum quantity we can order is 1kg.
But usually we can accept a smaller quantity, say 100g, at the cost of 100% sample charge.
Q6: Shipping Time?
A: We ship the parcel out in 1-2 days and offer tracking No.. Shipping time is different to different country. Please consult
| ACF Chemical Co., Ltd.
Leon phone/whatsapp:008615950692266 email:md@acfchemical.com No. 45 Pengwan Road, Qianwan Bonded Port Area, Qingdao Area, China (Shandong) |
|
| DMEA | 108-01-0 |
| Dodecyl trimethyl ammonium chloride | 112-00-5 |
| N-Hexadecyltrimethylammonium chloride | 112-02-7 |
| 1831 | 112-03-8 |
| 1631Br | 57-09-0 |
| D821 | 5538-94-3 |
| D8/1021 | 68424-95-3 |
| D1021 | 7173-51-5 |
| D1821 | 61789-80-8 |
| TEP88 | 157905-74-3 |
| 1227 C12 | 139-07-1 |
| DMPT(N,N-Dimethyl-p-toluidine) | 99-97-8 |
| NDPT(N,N-dihydroxyethyl-p-toluidine) | 3077-12-1. |
| DMA(N,N-dimethylaniline) | 121-69-7 |
| N,N-Diethylaniline | 91-66-7 |
| MT(M-Toluidine) | 108-44-1 |
| PT(P-Toluidine) | 106-49-0 |
| O-Toluidine OT | 95-53-4 |
| Dimethyl(octyl)amine | 7378-99-6/1120-24-7 |
| C16-18-alkyldimethyl Octadecyl/Hexadecyl dimethylamines | 68390-97-6 |
| Octadecyl/behenyl dimethylamines | 124046-42-0 |
| N,N-dimethyldocosylamine | 21542-96-1 |
| N-Methyldioctylamine | 4455-26-9 |
| Di(octyl/decyl) methylamines | 308062-61-5 |
| Didecyl methylamine | 7396-58-9 |
| N-methyldidodecylamine | 2915-90-4 |
| Dipalmitamine | 16724-61-1 |
| Trioctylamine | 1116-76-3 |
| Trioctylamine | 68814-95-9 |
| N-3-Laurylamidopropyl dimethylamine | 3179-80-4 |
| N-3-(Hydrogenated cocoamido)propyl dimethylamines | 288095-05-6 |
| N-3-Oleylamidopropyl dimethylamine | 109-28-4 |
| N-3-Erucylamidopropyl dimethylamine | 60270-33-9 |
| N-Oleyl 1,3-propanediamine | 7173-62-8 |
| Bis(aminopropyl)laurylamine | 2372-82-9 |
| N-tallow alkyltripropylenetetra | 68911-79-5 |
| 3-(isodecyloxy)propylamine | 30113-45-2 |
| N-[3-(isodecyloxy)propyl]propane-1,3-diamine | 72162-46-0 |
| 2-(Methylamino)ethanol | 109-83-1 |
| N-Methyldiethanolamine | 105-59-9 |
| 3-Methoxy propyl amine | 5332-73-0 |
| N,N-dimethylcyclohexylamine | 98-94-2 |
| 1,3,5-Tris[3-(dimethylamino)propyl]hexahydro-1,3,5-triazine | 15875-13-5 |
| N,N,N’-trimethylamino-N’-ethylethanolamine | 2212-32-0 |
| N,N-Dimethylethanolamine | 108-01-1 |
| Acetone | |
| Acrylic acid | |
| Adipic acid | |
| Alpha-Methylstyrene (AMS) | |
| Benzoic Acid | |
| Bisphenol A | |
| Butyl Acrylat (BA) | |
| Butyl acetate (Butac) | |
| Butyl diglycol (BDG) | |
| Butyl glycol | |
| Para-tertiary butyl benzoic acid (PTBBA) | |
| n-Butanol | |
| n-Butyl methacrylate (n-BUMA) | |
| para-tert. Butylphenol (PTBP) | |










